C16H36O4 — CID 160572905
2-ethylhexane-1,3-diol;octane-1,3-diol (PubChem CID 160572905) has the molecular formula C16H36O4 and a molecular weight of 292.46 g/mol. Its IUPAC name is 2-ethylhexane-1,3-diol;octane-1,3-diol.
| Compound Name | 2-ethylhexane-1,3-diol;octane-1,3-diol |
|---|---|
| PubChem CID | 160572905 |
| Molecular Formula | C16H36O4 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 2-ethylhexane-1,3-diol;octane-1,3-diol |
| SMILES | CCCC(O)C(CC)CO.CCCCCC(O)CCO |
| InChI | InChI=1S/2C8H18O2/c1-3-5-8(10)7(4-2)6-9;1-2-3-4-5-8(10)6-7-9/h7-10H,3-6H2,1-2H3;8-10H,2-7H2,1H3 |
| InChIKey | RATVYAPUIZMYMB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|