About 4-ethyloctane-1,3-diol
4-ethyloctane-1,3-diol (PubChem CID 57022453) has the molecular formula C10H22O2
and a molecular weight of 174.28 g/mol. Its IUPAC name is 4-ethyloctane-1,3-diol.
Molecular Properties
| Compound Name | 4-ethyloctane-1,3-diol |
| PubChem CID | 57022453 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | 4-ethyloctane-1,3-diol |
| SMILES | CCCCC(CC)C(O)CCO |
| InChI | InChI=1S/C10H22O2/c1-3-5-6-9(4-2)10(12)7-8-11/h9-12H,3-8H2,1-2H3 |
| InChIKey | PSLQXKVLHHZPLW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyloctane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyloctane-1,3-diol?
The IUPAC name of 4-ethyloctane-1,3-diol (CID 57022453) is 4-ethyloctane-1,3-diol.
What is the SMILES notation for 4-ethyloctane-1,3-diol?
The canonical SMILES for 4-ethyloctane-1,3-diol is CCCCC(CC)C(O)CCO.
What is the InChIKey of 4-ethyloctane-1,3-diol?
The InChIKey is PSLQXKVLHHZPLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O2/c1-3-5-6-9(4-2)10(12)7-8-11/h9-12H,3-8H2,1-2H3.
What are the key properties of 4-ethyloctane-1,3-diol?
4-ethyloctane-1,3-diol has a molecular weight of 174.28 g/mol, XLogP of 1.95, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyloctane-1,3-diol is sourced from PubChem (CID 57022453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).