About 6-ethyloctadecan-7-ol
6-ethyloctadecan-7-ol (PubChem CID 22321194) has the molecular formula C20H42O
and a molecular weight of 298.56 g/mol. Its IUPAC name is 6-ethyloctadecan-7-ol.
Molecular Properties
| Compound Name | 6-ethyloctadecan-7-ol |
| PubChem CID | 22321194 |
| Molecular Formula | C20H42O |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.32 |
| IUPAC Name | 6-ethyloctadecan-7-ol |
| SMILES | CCCCCCCCCCCC(O)C(CC)CCCCC |
| InChI | InChI=1S/C20H42O/c1-4-7-9-10-11-12-13-14-16-18-20(21)19(6-3)17-15-8-5-2/h19-21H,4-18H2,1-3H3 |
| InChIKey | HUEWVVLAWVXECZ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyloctadecan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyloctadecan-7-ol?
The IUPAC name of 6-ethyloctadecan-7-ol (CID 22321194) is 6-ethyloctadecan-7-ol.
What is the SMILES notation for 6-ethyloctadecan-7-ol?
The canonical SMILES for 6-ethyloctadecan-7-ol is CCCCCCCCCCCC(O)C(CC)CCCCC.
What is the InChIKey of 6-ethyloctadecan-7-ol?
The InChIKey is HUEWVVLAWVXECZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O/c1-4-7-9-10-11-12-13-14-16-18-20(21)19(6-3)17-15-8-5-2/h19-21H,4-18H2,1-3H3.
What are the key properties of 6-ethyloctadecan-7-ol?
6-ethyloctadecan-7-ol has a molecular weight of 298.56 g/mol, XLogP of 6.87, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyloctadecan-7-ol is sourced from PubChem (CID 22321194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).