C17H38O4 — CID 174808442
2,4-diethylpentane-1,5-diol;2-ethylhexane-1,3-diol (PubChem CID 174808442) has the molecular formula C17H38O4 and a molecular weight of 306.49 g/mol. Its IUPAC name is 2,4-diethylpentane-1,5-diol;2-ethylhexane-1,3-diol.
| Compound Name | 2,4-diethylpentane-1,5-diol;2-ethylhexane-1,3-diol |
|---|---|
| PubChem CID | 174808442 |
| Molecular Formula | C17H38O4 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.28 |
| IUPAC Name | 2,4-diethylpentane-1,5-diol;2-ethylhexane-1,3-diol |
| SMILES | CCC(CO)CC(CC)CO.CCCC(O)C(CC)CO |
| InChI | InChI=1S/C9H20O2.C8H18O2/c1-3-8(6-10)5-9(4-2)7-11;1-3-5-8(10)7(4-2)6-9/h8-11H,3-7H2,1-2H3;7-10H,3-6H2,1-2H3 |
| InChIKey | PMZUTACFGFCYAZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |