C12H24O8 — CID 161019613
2,3-dihydroxybutanedioic acid;2-ethylhexane-1,3-diol (PubChem CID 161019613) has the molecular formula C12H24O8 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;2-ethylhexane-1,3-diol.
| Compound Name | 2,3-dihydroxybutanedioic acid;2-ethylhexane-1,3-diol |
|---|---|
| PubChem CID | 161019613 |
| Molecular Formula | C12H24O8 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;2-ethylhexane-1,3-diol |
| SMILES | CCCC(O)C(CC)CO.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C8H18O2.C4H6O6/c1-3-5-8(10)7(4-2)6-9;5-1(3(7)8)2(6)4(9)10/h7-10H,3-6H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | TYEPORJREJYGLX-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |