2,4-dihydroxy-3-(hydroxymethyl)butanoic acid

C5H10O5 — CID 18767454

IUPAC2,4-dihydroxy-3-(hydroxymethyl)butanoic acid
SMILESO=C(O)C(O)C(CO)CO
InChIInChI=1S/C5H10O5/c6-1-3(2-7)4(8)5(9)10/h3-4,6-8H,1-2H2,(H,9,10)
InChIKeyRXVSUXOYOCJMAP-UHFFFAOYSA-N
MW150.13 g/mol
LogP-1.97
Rot. Bonds4

About 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid

2,4-dihydroxy-3-(hydroxymethyl)butanoic acid (PubChem CID 18767454) has the molecular formula C5H10O5 and a molecular weight of 150.13 g/mol. Its IUPAC name is 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid.

Molecular Properties

Compound Name2,4-dihydroxy-3-(hydroxymethyl)butanoic acid
PubChem CID18767454
Molecular FormulaC5H10O5
Molecular Weight150.13 g/mol
Exact Mass150.05
IUPAC Name2,4-dihydroxy-3-(hydroxymethyl)butanoic acid
SMILESO=C(O)C(O)C(CO)CO
InChIInChI=1S/C5H10O5/c6-1-3(2-7)4(8)5(9)10/h3-4,6-8H,1-2H2,(H,9,10)
InChIKeyRXVSUXOYOCJMAP-UHFFFAOYSA-N
XLogP-1.97
TPSA97.99 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.13
LogP ≤ 5-1.97
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid?
The IUPAC name of 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid (CID 18767454) is 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid.
What is the SMILES notation for 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid?
The canonical SMILES for 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid is O=C(O)C(O)C(CO)CO.
What is the InChIKey of 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid?
The InChIKey is RXVSUXOYOCJMAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O5/c6-1-3(2-7)4(8)5(9)10/h3-4,6-8H,1-2H2,(H,9,10).
What are the key properties of 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid?
2,4-dihydroxy-3-(hydroxymethyl)butanoic acid has a molecular weight of 150.13 g/mol, XLogP of -1.97, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid is sourced from PubChem (CID 18767454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).