C5H10O5 — CID 18767454
2,4-dihydroxy-3-(hydroxymethyl)butanoic acid (PubChem CID 18767454) has the molecular formula C5H10O5 and a molecular weight of 150.13 g/mol. Its IUPAC name is 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid.
| Compound Name | 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid |
|---|---|
| PubChem CID | 18767454 |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 2,4-dihydroxy-3-(hydroxymethyl)butanoic acid |
| SMILES | O=C(O)C(O)C(CO)CO |
| InChI | InChI=1S/C5H10O5/c6-1-3(2-7)4(8)5(9)10/h3-4,6-8H,1-2H2,(H,9,10) |
| InChIKey | RXVSUXOYOCJMAP-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |