C7H17BO12 — CID 172857542
boric acid;(2R,3R)-2,3-dihydroxybutanedioic acid;propane-1,2,3-triol (PubChem CID 172857542) has the molecular formula C7H17BO12 and a molecular weight of 304.01 g/mol. Its IUPAC name is boric acid;(2R,3R)-2,3-dihydroxybutanedioic acid;propane-1,2,3-triol.
| Compound Name | boric acid;(2R,3R)-2,3-dihydroxybutanedioic acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 172857542 |
| Molecular Formula | C7H17BO12 |
| Molecular Weight | 304.01 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | boric acid;(2R,3R)-2,3-dihydroxybutanedioic acid;propane-1,2,3-triol |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(=O)O.OB(O)O.OCC(O)CO |
| InChI | InChI=1S/C4H6O6.C3H8O3.BH3O3/c5-1(3(7)8)2(6)4(9)10;4-1-3(6)2-5;2-1(3)4/h1-2,5-6H,(H,7,8)(H,9,10);3-6H,1-2H2;2-4H/t1-,2-;;/m1../s1 |
| InChIKey | YXLBUAUUZZKSST-OLXYHTOASA-N |
| XLogP | -5.84 |
| TPSA | 236.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.01 |
| LogP ≤ 5 | -5.84 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|