C8H16O7 — CID 174817695
2-ethylpropanedioic acid;propane-1,2,3-triol (PubChem CID 174817695) has the molecular formula C8H16O7 and a molecular weight of 224.21 g/mol. Its IUPAC name is 2-ethylpropanedioic acid;propane-1,2,3-triol.
| Compound Name | 2-ethylpropanedioic acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 174817695 |
| Molecular Formula | C8H16O7 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-ethylpropanedioic acid;propane-1,2,3-triol |
| SMILES | CCC(C(=O)O)C(=O)O.OCC(O)CO |
| InChI | InChI=1S/C5H8O4.C3H8O3/c1-2-3(4(6)7)5(8)9;4-1-3(6)2-5/h3H,2H2,1H3,(H,6,7)(H,8,9);3-6H,1-2H2 |
| InChIKey | PRLGNUKZFZQQIR-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|