About ethanol;2-ethyl-3-oxobutanoic acid
ethanol;2-ethyl-3-oxobutanoic acid (PubChem CID 87682389) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is ethanol;2-ethyl-3-oxobutanoic acid.
Molecular Properties
| Compound Name | ethanol;2-ethyl-3-oxobutanoic acid |
| PubChem CID | 87682389 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | ethanol;2-ethyl-3-oxobutanoic acid |
| SMILES | CCC(C(C)=O)C(=O)O.CCO |
| InChI | InChI=1S/C6H10O3.C2H6O/c1-3-5(4(2)7)6(8)9;1-2-3/h5H,3H2,1-2H3,(H,8,9);3H,2H2,1H3 |
| InChIKey | KPSXSIVAYVXFNW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethanol;2-ethyl-3-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-ethyl-3-oxobutanoic acid?
The IUPAC name of ethanol;2-ethyl-3-oxobutanoic acid (CID 87682389) is ethanol;2-ethyl-3-oxobutanoic acid.
What is the SMILES notation for ethanol;2-ethyl-3-oxobutanoic acid?
The canonical SMILES for ethanol;2-ethyl-3-oxobutanoic acid is CCC(C(C)=O)C(=O)O.CCO.
What is the InChIKey of ethanol;2-ethyl-3-oxobutanoic acid?
The InChIKey is KPSXSIVAYVXFNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C2H6O/c1-3-5(4(2)7)6(8)9;1-2-3/h5H,3H2,1-2H3,(H,8,9);3H,2H2,1H3.
What are the key properties of ethanol;2-ethyl-3-oxobutanoic acid?
ethanol;2-ethyl-3-oxobutanoic acid has a molecular weight of 176.21 g/mol, XLogP of 0.68, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-ethyl-3-oxobutanoic acid is sourced from PubChem (CID 87682389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).