C6H10O3 — CID 21422016
3-(hydroxymethyl)pentane-2,4-dione (PubChem CID 21422016) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is 3-(hydroxymethyl)pentane-2,4-dione.
| Compound Name | 3-(hydroxymethyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 21422016 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 3-(hydroxymethyl)pentane-2,4-dione |
| SMILES | CC(=O)C(CO)C(C)=O |
| InChI | InChI=1S/C6H10O3/c1-4(8)6(3-7)5(2)9/h6-7H,3H2,1-2H3 |
| InChIKey | ZXRQBQKGHWBGDN-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|