About methanol;methyl acetate;2-methylpropan-1-ol
methanol;methyl acetate;2-methylpropan-1-ol (PubChem CID 87865598) has the molecular formula C8H20O4
and a molecular weight of 180.24 g/mol. Its IUPAC name is methanol;methyl acetate;2-methylpropan-1-ol.
Molecular Properties
| Compound Name | methanol;methyl acetate;2-methylpropan-1-ol |
| PubChem CID | 87865598 |
| Molecular Formula | C8H20O4 |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | methanol;methyl acetate;2-methylpropan-1-ol |
| SMILES | CC(C)CO.CO.COC(C)=O |
| InChI | InChI=1S/C4H10O.C3H6O2.CH4O/c1-4(2)3-5;1-3(4)5-2;1-2/h4-5H,3H2,1-2H3;1-2H3;2H,1H3 |
| InChIKey | YTVHBHBBELPDPG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanol;methyl acetate;2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;methyl acetate;2-methylpropan-1-ol?
The IUPAC name of methanol;methyl acetate;2-methylpropan-1-ol (CID 87865598) is methanol;methyl acetate;2-methylpropan-1-ol.
What is the SMILES notation for methanol;methyl acetate;2-methylpropan-1-ol?
The canonical SMILES for methanol;methyl acetate;2-methylpropan-1-ol is CC(C)CO.CO.COC(C)=O.
What is the InChIKey of methanol;methyl acetate;2-methylpropan-1-ol?
The InChIKey is YTVHBHBBELPDPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.C3H6O2.CH4O/c1-4(2)3-5;1-3(4)5-2;1-2/h4-5H,3H2,1-2H3;1-2H3;2H,1H3.
What are the key properties of methanol;methyl acetate;2-methylpropan-1-ol?
methanol;methyl acetate;2-methylpropan-1-ol has a molecular weight of 180.24 g/mol, XLogP of 0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;methyl acetate;2-methylpropan-1-ol is sourced from PubChem (CID 87865598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).