About bismuthane;methyl acetate
bismuthane;methyl acetate (PubChem CID 174537209) has the molecular formula C3H9BiO2
and a molecular weight of 286.08 g/mol. Its IUPAC name is bismuthane;methyl acetate.
Molecular Properties
| Compound Name | bismuthane;methyl acetate |
| PubChem CID | 174537209 |
| Molecular Formula | C3H9BiO2 |
| Molecular Weight | 286.08 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | bismuthane;methyl acetate |
| SMILES | COC(C)=O.[BiH3] |
| InChI | InChI=1S/C3H6O2.Bi.3H/c1-3(4)5-2;;;;/h1-2H3;;;; |
| InChIKey | HHEICEKDHKDQGI-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.08 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bismuthane;methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bismuthane;methyl acetate?
The IUPAC name of bismuthane;methyl acetate (CID 174537209) is bismuthane;methyl acetate.
What is the SMILES notation for bismuthane;methyl acetate?
The canonical SMILES for bismuthane;methyl acetate is COC(C)=O.[BiH3].
What is the InChIKey of bismuthane;methyl acetate?
The InChIKey is HHEICEKDHKDQGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.Bi.3H/c1-3(4)5-2;;;;/h1-2H3;;;;.
What are the key properties of bismuthane;methyl acetate?
bismuthane;methyl acetate has a molecular weight of 286.08 g/mol, XLogP of -1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bismuthane;methyl acetate is sourced from PubChem (CID 174537209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).