About copper;methyl acetate
copper;methyl acetate (PubChem CID 174340034) has the molecular formula C3H6CuO2
and a molecular weight of 137.62 g/mol. Its IUPAC name is copper;methyl acetate.
Molecular Properties
| Compound Name | copper;methyl acetate |
| PubChem CID | 174340034 |
| Molecular Formula | C3H6CuO2 |
| Molecular Weight | 137.62 g/mol |
| Exact Mass | 136.97 |
| IUPAC Name | copper;methyl acetate |
| SMILES | COC(C)=O.[Cu] |
| InChI | InChI=1S/C3H6O2.Cu/c1-3(4)5-2;/h1-2H3; |
| InChIKey | SASPQQQEBFAIIE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.62 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper;methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;methyl acetate?
The IUPAC name of copper;methyl acetate (CID 174340034) is copper;methyl acetate.
What is the SMILES notation for copper;methyl acetate?
The canonical SMILES for copper;methyl acetate is COC(C)=O.[Cu].
What is the InChIKey of copper;methyl acetate?
The InChIKey is SASPQQQEBFAIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.Cu/c1-3(4)5-2;/h1-2H3;.
What are the key properties of copper;methyl acetate?
copper;methyl acetate has a molecular weight of 137.62 g/mol, XLogP of 0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;methyl acetate is sourced from PubChem (CID 174340034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).