C12H18O4 — CID 4712238
3,6-diacetyloctane-2,7-dione (PubChem CID 4712238) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 3,6-diacetyloctane-2,7-dione.
| Compound Name | 3,6-diacetyloctane-2,7-dione |
|---|---|
| PubChem CID | 4712238 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3,6-diacetyloctane-2,7-dione |
| SMILES | CC(=O)C(CCC(C(C)=O)C(C)=O)C(C)=O |
| InChI | InChI=1S/C12H18O4/c1-7(13)11(8(2)14)5-6-12(9(3)15)10(4)16/h11-12H,5-6H2,1-4H3 |
| InChIKey | KNYDYWGXJLHAIZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|