About 5-acetyl-6-oxoheptanoic acid
5-acetyl-6-oxoheptanoic acid (PubChem CID 21079454) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 5-acetyl-6-oxoheptanoic acid.
Molecular Properties
| Compound Name | 5-acetyl-6-oxoheptanoic acid |
| PubChem CID | 21079454 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 5-acetyl-6-oxoheptanoic acid |
| SMILES | CC(=O)C(CCCC(=O)O)C(C)=O |
| InChI | InChI=1S/C9H14O4/c1-6(10)8(7(2)11)4-3-5-9(12)13/h8H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | RKLJMZJPOFUMRB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-6-oxoheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-6-oxoheptanoic acid?
The IUPAC name of 5-acetyl-6-oxoheptanoic acid (CID 21079454) is 5-acetyl-6-oxoheptanoic acid.
What is the SMILES notation for 5-acetyl-6-oxoheptanoic acid?
The canonical SMILES for 5-acetyl-6-oxoheptanoic acid is CC(=O)C(CCCC(=O)O)C(C)=O.
What is the InChIKey of 5-acetyl-6-oxoheptanoic acid?
The InChIKey is RKLJMZJPOFUMRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-6(10)8(7(2)11)4-3-5-9(12)13/h8H,3-5H2,1-2H3,(H,12,13).
What are the key properties of 5-acetyl-6-oxoheptanoic acid?
5-acetyl-6-oxoheptanoic acid has a molecular weight of 186.21 g/mol, XLogP of 1.04, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-6-oxoheptanoic acid is sourced from PubChem (CID 21079454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).