About (5R)-5-acetyloxyhexanoic acid
(5R)-5-acetyloxyhexanoic acid (PubChem CID 87649956) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is (5R)-5-acetyloxyhexanoic acid.
Molecular Properties
| Compound Name | (5R)-5-acetyloxyhexanoic acid |
| PubChem CID | 87649956 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (5R)-5-acetyloxyhexanoic acid |
| SMILES | CC(=O)O[C@H](C)CCCC(=O)O |
| InChI | InChI=1S/C8H14O4/c1-6(12-7(2)9)4-3-5-8(10)11/h6H,3-5H2,1-2H3,(H,10,11)/t6-/m1/s1 |
| InChIKey | OGTFPNUUYVXZCH-ZCFIWIBFSA-N |
| XLogP | 1.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R)-5-acetyloxyhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-acetyloxyhexanoic acid?
The IUPAC name of (5R)-5-acetyloxyhexanoic acid (CID 87649956) is (5R)-5-acetyloxyhexanoic acid.
What is the SMILES notation for (5R)-5-acetyloxyhexanoic acid?
The canonical SMILES for (5R)-5-acetyloxyhexanoic acid is CC(=O)O[C@H](C)CCCC(=O)O.
What is the InChIKey of (5R)-5-acetyloxyhexanoic acid?
The InChIKey is OGTFPNUUYVXZCH-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H14O4/c1-6(12-7(2)9)4-3-5-8(10)11/h6H,3-5H2,1-2H3,(H,10,11)/t6-/m1/s1.
What are the key properties of (5R)-5-acetyloxyhexanoic acid?
(5R)-5-acetyloxyhexanoic acid has a molecular weight of 174.20 g/mol, XLogP of 1.19, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-acetyloxyhexanoic acid is sourced from PubChem (CID 87649956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).