About 6-hydroxyhexan-2-yl acetate
6-hydroxyhexan-2-yl acetate (PubChem CID 15812148) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 6-hydroxyhexan-2-yl acetate.
Molecular Properties
| Compound Name | 6-hydroxyhexan-2-yl acetate |
| PubChem CID | 15812148 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 6-hydroxyhexan-2-yl acetate |
| SMILES | CC(=O)OC(C)CCCCO |
| InChI | InChI=1S/C8H16O3/c1-7(11-8(2)10)5-3-4-6-9/h7,9H,3-6H2,1-2H3 |
| InChIKey | ZXKPHTVUWHNDBK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexan-2-yl acetate?
The IUPAC name of 6-hydroxyhexan-2-yl acetate (CID 15812148) is 6-hydroxyhexan-2-yl acetate.
What is the SMILES notation for 6-hydroxyhexan-2-yl acetate?
The canonical SMILES for 6-hydroxyhexan-2-yl acetate is CC(=O)OC(C)CCCCO.
What is the InChIKey of 6-hydroxyhexan-2-yl acetate?
The InChIKey is ZXKPHTVUWHNDBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-7(11-8(2)10)5-3-4-6-9/h7,9H,3-6H2,1-2H3.
What are the key properties of 6-hydroxyhexan-2-yl acetate?
6-hydroxyhexan-2-yl acetate has a molecular weight of 160.21 g/mol, XLogP of 1.10, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexan-2-yl acetate is sourced from PubChem (CID 15812148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).