About [(2R)-6-bromohexan-2-yl] acetate
[(2R)-6-bromohexan-2-yl] acetate (PubChem CID 12619445) has the molecular formula C8H15BrO2
and a molecular weight of 223.11 g/mol. Its IUPAC name is [(2R)-6-bromohexan-2-yl] acetate.
Molecular Properties
| Compound Name | [(2R)-6-bromohexan-2-yl] acetate |
| PubChem CID | 12619445 |
| Molecular Formula | C8H15BrO2 |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | [(2R)-6-bromohexan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](C)CCCCBr |
| InChI | InChI=1S/C8H15BrO2/c1-7(11-8(2)10)5-3-4-6-9/h7H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | LLZXFIZGAPQADJ-SSDOTTSWSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-6-bromohexan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-6-bromohexan-2-yl] acetate?
The IUPAC name of [(2R)-6-bromohexan-2-yl] acetate (CID 12619445) is [(2R)-6-bromohexan-2-yl] acetate.
What is the SMILES notation for [(2R)-6-bromohexan-2-yl] acetate?
The canonical SMILES for [(2R)-6-bromohexan-2-yl] acetate is CC(=O)O[C@H](C)CCCCBr.
What is the InChIKey of [(2R)-6-bromohexan-2-yl] acetate?
The InChIKey is LLZXFIZGAPQADJ-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H15BrO2/c1-7(11-8(2)10)5-3-4-6-9/h7H,3-6H2,1-2H3/t7-/m1/s1.
What are the key properties of [(2R)-6-bromohexan-2-yl] acetate?
[(2R)-6-bromohexan-2-yl] acetate has a molecular weight of 223.11 g/mol, XLogP of 2.50, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-6-bromohexan-2-yl] acetate is sourced from PubChem (CID 12619445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).