About 5-chlorohexanoic acid
5-chlorohexanoic acid (PubChem CID 18541668) has the molecular formula C6H11ClO2
and a molecular weight of 150.60 g/mol. Its IUPAC name is 5-chlorohexanoic acid.
Molecular Properties
| Compound Name | 5-chlorohexanoic acid |
| PubChem CID | 18541668 |
| Molecular Formula | C6H11ClO2 |
| Molecular Weight | 150.60 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 5-chlorohexanoic acid |
| SMILES | CC(Cl)CCCC(=O)O |
| InChI | InChI=1S/C6H11ClO2/c1-5(7)3-2-4-6(8)9/h5H,2-4H2,1H3,(H,8,9) |
| InChIKey | BKYXJMPZIUFVJA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.60 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chlorohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chlorohexanoic acid?
The IUPAC name of 5-chlorohexanoic acid (CID 18541668) is 5-chlorohexanoic acid.
What is the SMILES notation for 5-chlorohexanoic acid?
The canonical SMILES for 5-chlorohexanoic acid is CC(Cl)CCCC(=O)O.
What is the InChIKey of 5-chlorohexanoic acid?
The InChIKey is BKYXJMPZIUFVJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClO2/c1-5(7)3-2-4-6(8)9/h5H,2-4H2,1H3,(H,8,9).
What are the key properties of 5-chlorohexanoic acid?
5-chlorohexanoic acid has a molecular weight of 150.60 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chlorohexanoic acid is sourced from PubChem (CID 18541668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).