5-chlorohexanoic acid

C6H11ClO2 — CID 18541668

IUPAC5-chlorohexanoic acid
SMILESCC(Cl)CCCC(=O)O
InChIInChI=1S/C6H11ClO2/c1-5(7)3-2-4-6(8)9/h5H,2-4H2,1H3,(H,8,9)
InChIKeyBKYXJMPZIUFVJA-UHFFFAOYSA-N
MW150.60 g/mol
LogP1.87
Rot. Bonds4

About 5-chlorohexanoic acid

5-chlorohexanoic acid (PubChem CID 18541668) has the molecular formula C6H11ClO2 and a molecular weight of 150.60 g/mol. Its IUPAC name is 5-chlorohexanoic acid.

Molecular Properties

Compound Name5-chlorohexanoic acid
PubChem CID18541668
Molecular FormulaC6H11ClO2
Molecular Weight150.60 g/mol
Exact Mass150.04
IUPAC Name5-chlorohexanoic acid
SMILESCC(Cl)CCCC(=O)O
InChIInChI=1S/C6H11ClO2/c1-5(7)3-2-4-6(8)9/h5H,2-4H2,1H3,(H,8,9)
InChIKeyBKYXJMPZIUFVJA-UHFFFAOYSA-N
XLogP1.87
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.60
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 5-chlorohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chlorohexanoic acid?
The IUPAC name of 5-chlorohexanoic acid (CID 18541668) is 5-chlorohexanoic acid.
What is the SMILES notation for 5-chlorohexanoic acid?
The canonical SMILES for 5-chlorohexanoic acid is CC(Cl)CCCC(=O)O.
What is the InChIKey of 5-chlorohexanoic acid?
The InChIKey is BKYXJMPZIUFVJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClO2/c1-5(7)3-2-4-6(8)9/h5H,2-4H2,1H3,(H,8,9).
What are the key properties of 5-chlorohexanoic acid?
5-chlorohexanoic acid has a molecular weight of 150.60 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chlorohexanoic acid is sourced from PubChem (CID 18541668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).