About 5-isothiocyanatohexanoic acid
5-isothiocyanatohexanoic acid (PubChem CID 87482879) has the molecular formula C7H11NO2S
and a molecular weight of 173.24 g/mol. Its IUPAC name is 5-isothiocyanatohexanoic acid.
Molecular Properties
| Compound Name | 5-isothiocyanatohexanoic acid |
| PubChem CID | 87482879 |
| Molecular Formula | C7H11NO2S |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 5-isothiocyanatohexanoic acid |
| SMILES | CC(CCCC(=O)O)N=C=S |
| InChI | InChI=1S/C7H11NO2S/c1-6(8-5-11)3-2-4-7(9)10/h6H,2-4H2,1H3,(H,9,10) |
| InChIKey | HCVHOWVTFWEVFT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-isothiocyanatohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isothiocyanatohexanoic acid?
The IUPAC name of 5-isothiocyanatohexanoic acid (CID 87482879) is 5-isothiocyanatohexanoic acid.
What is the SMILES notation for 5-isothiocyanatohexanoic acid?
The canonical SMILES for 5-isothiocyanatohexanoic acid is CC(CCCC(=O)O)N=C=S.
What is the InChIKey of 5-isothiocyanatohexanoic acid?
The InChIKey is HCVHOWVTFWEVFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2S/c1-6(8-5-11)3-2-4-7(9)10/h6H,2-4H2,1H3,(H,9,10).
What are the key properties of 5-isothiocyanatohexanoic acid?
5-isothiocyanatohexanoic acid has a molecular weight of 173.24 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isothiocyanatohexanoic acid is sourced from PubChem (CID 87482879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).