C26H53N3O2 — CID 174947314
4-(iminomethylideneamino)-N,N-dimethylpentan-1-amine;octadecanoic acid (PubChem CID 174947314) has the molecular formula C26H53N3O2 and a molecular weight of 439.73 g/mol. Its IUPAC name is 4-(iminomethylideneamino)-N,N-dimethylpentan-1-amine;octadecanoic acid.
| Compound Name | 4-(iminomethylideneamino)-N,N-dimethylpentan-1-amine;octadecanoic acid |
|---|---|
| PubChem CID | 174947314 |
| Molecular Formula | C26H53N3O2 |
| Molecular Weight | 439.73 g/mol |
| Exact Mass | 439.41 |
| IUPAC Name | 4-(iminomethylideneamino)-N,N-dimethylpentan-1-amine;octadecanoic acid |
| SMILES | CC(CCCN(C)C)N=C=N.CCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O2.C8H17N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-8(10-7-9)5-4-6-11(2)3/h2-17H2,1H3,(H,19,20);8-9H,4-6H2,1-3H3 |
| InChIKey | DNOIVDYWORNFEJ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 76.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.73 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|