About 11-isocyanatododecanoic acid
11-isocyanatododecanoic acid (PubChem CID 21452299) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is 11-isocyanatododecanoic acid.
Molecular Properties
| Compound Name | 11-isocyanatododecanoic acid |
| PubChem CID | 21452299 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 11-isocyanatododecanoic acid |
| SMILES | CC(CCCCCCCCCC(=O)O)N=C=O |
| InChI | InChI=1S/C13H23NO3/c1-12(14-11-15)9-7-5-3-2-4-6-8-10-13(16)17/h12H,2-10H2,1H3,(H,16,17) |
| InChIKey | VNPKJEZQINMAEG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 11-isocyanatododecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-isocyanatododecanoic acid?
The IUPAC name of 11-isocyanatododecanoic acid (CID 21452299) is 11-isocyanatododecanoic acid.
What is the SMILES notation for 11-isocyanatododecanoic acid?
The canonical SMILES for 11-isocyanatododecanoic acid is CC(CCCCCCCCCC(=O)O)N=C=O.
What is the InChIKey of 11-isocyanatododecanoic acid?
The InChIKey is VNPKJEZQINMAEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO3/c1-12(14-11-15)9-7-5-3-2-4-6-8-10-13(16)17/h12H,2-10H2,1H3,(H,16,17).
What are the key properties of 11-isocyanatododecanoic acid?
11-isocyanatododecanoic acid has a molecular weight of 241.33 g/mol, XLogP of 3.31, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-isocyanatododecanoic acid is sourced from PubChem (CID 21452299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).