About 5-methylhexanoic acid;4-methylpentan-1-ol
5-methylhexanoic acid;4-methylpentan-1-ol (PubChem CID 87646285) has the molecular formula C13H28O3
and a molecular weight of 232.36 g/mol. Its IUPAC name is 5-methylhexanoic acid;4-methylpentan-1-ol.
Molecular Properties
| Compound Name | 5-methylhexanoic acid;4-methylpentan-1-ol |
| PubChem CID | 87646285 |
| Molecular Formula | C13H28O3 |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 5-methylhexanoic acid;4-methylpentan-1-ol |
| SMILES | CC(C)CCCC(=O)O.CC(C)CCCO |
| InChI | InChI=1S/C7H14O2.C6H14O/c1-6(2)4-3-5-7(8)9;1-6(2)4-3-5-7/h6H,3-5H2,1-2H3,(H,8,9);6-7H,3-5H2,1-2H3 |
| InChIKey | RDYTVYJQCNTFDU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methylhexanoic acid;4-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhexanoic acid;4-methylpentan-1-ol?
The IUPAC name of 5-methylhexanoic acid;4-methylpentan-1-ol (CID 87646285) is 5-methylhexanoic acid;4-methylpentan-1-ol.
What is the SMILES notation for 5-methylhexanoic acid;4-methylpentan-1-ol?
The canonical SMILES for 5-methylhexanoic acid;4-methylpentan-1-ol is CC(C)CCCC(=O)O.CC(C)CCCO.
What is the InChIKey of 5-methylhexanoic acid;4-methylpentan-1-ol?
The InChIKey is RDYTVYJQCNTFDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.C6H14O/c1-6(2)4-3-5-7(8)9;1-6(2)4-3-5-7/h6H,3-5H2,1-2H3,(H,8,9);6-7H,3-5H2,1-2H3.
What are the key properties of 5-methylhexanoic acid;4-methylpentan-1-ol?
5-methylhexanoic acid;4-methylpentan-1-ol has a molecular weight of 232.36 g/mol, XLogP of 3.31, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhexanoic acid;4-methylpentan-1-ol is sourced from PubChem (CID 87646285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).