About 8-chloro-4-oxononanoic acid
8-chloro-4-oxononanoic acid (PubChem CID 56994510) has the molecular formula C9H15ClO3
and a molecular weight of 206.67 g/mol. Its IUPAC name is 8-chloro-4-oxononanoic acid.
Molecular Properties
| Compound Name | 8-chloro-4-oxononanoic acid |
| PubChem CID | 56994510 |
| Molecular Formula | C9H15ClO3 |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 8-chloro-4-oxononanoic acid |
| SMILES | CC(Cl)CCCC(=O)CCC(=O)O |
| InChI | InChI=1S/C9H15ClO3/c1-7(10)3-2-4-8(11)5-6-9(12)13/h7H,2-6H2,1H3,(H,12,13) |
| InChIKey | XXWQWUSYBOITSQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-4-oxononanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-4-oxononanoic acid?
The IUPAC name of 8-chloro-4-oxononanoic acid (CID 56994510) is 8-chloro-4-oxononanoic acid.
What is the SMILES notation for 8-chloro-4-oxononanoic acid?
The canonical SMILES for 8-chloro-4-oxononanoic acid is CC(Cl)CCCC(=O)CCC(=O)O.
What is the InChIKey of 8-chloro-4-oxononanoic acid?
The InChIKey is XXWQWUSYBOITSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClO3/c1-7(10)3-2-4-8(11)5-6-9(12)13/h7H,2-6H2,1H3,(H,12,13).
What are the key properties of 8-chloro-4-oxononanoic acid?
8-chloro-4-oxononanoic acid has a molecular weight of 206.67 g/mol, XLogP of 2.22, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-4-oxononanoic acid is sourced from PubChem (CID 56994510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).