About 9-hydroxy-4-oxononanoic acid
9-hydroxy-4-oxononanoic acid (PubChem CID 159708655) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 9-hydroxy-4-oxononanoic acid.
Molecular Properties
| Compound Name | 9-hydroxy-4-oxononanoic acid |
| PubChem CID | 159708655 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 9-hydroxy-4-oxononanoic acid |
| SMILES | O=C(O)CCC(=O)CCCCCO |
| InChI | InChI=1S/C9H16O4/c10-7-3-1-2-4-8(11)5-6-9(12)13/h10H,1-7H2,(H,12,13) |
| InChIKey | ZCOFRYFVWOVXKM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxy-4-oxononanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-4-oxononanoic acid?
The IUPAC name of 9-hydroxy-4-oxononanoic acid (CID 159708655) is 9-hydroxy-4-oxononanoic acid.
What is the SMILES notation for 9-hydroxy-4-oxononanoic acid?
The canonical SMILES for 9-hydroxy-4-oxononanoic acid is O=C(O)CCC(=O)CCCCCO.
What is the InChIKey of 9-hydroxy-4-oxononanoic acid?
The InChIKey is ZCOFRYFVWOVXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c10-7-3-1-2-4-8(11)5-6-9(12)13/h10H,1-7H2,(H,12,13).
What are the key properties of 9-hydroxy-4-oxononanoic acid?
9-hydroxy-4-oxononanoic acid has a molecular weight of 188.22 g/mol, XLogP of 0.97, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-4-oxononanoic acid is sourced from PubChem (CID 159708655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).