About 4,7-dioxoundecanoic acid
4,7-dioxoundecanoic acid (PubChem CID 165359282) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is 4,7-dioxoundecanoic acid.
Molecular Properties
| Compound Name | 4,7-dioxoundecanoic acid |
| PubChem CID | 165359282 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 4,7-dioxoundecanoic acid |
| SMILES | CCCCC(=O)CCC(=O)CCC(=O)O |
| InChI | InChI=1S/C11H18O4/c1-2-3-4-9(12)5-6-10(13)7-8-11(14)15/h2-8H2,1H3,(H,14,15) |
| InChIKey | NUIDLEYBFLNNHV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,7-dioxoundecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dioxoundecanoic acid?
The IUPAC name of 4,7-dioxoundecanoic acid (CID 165359282) is 4,7-dioxoundecanoic acid.
What is the SMILES notation for 4,7-dioxoundecanoic acid?
The canonical SMILES for 4,7-dioxoundecanoic acid is CCCCC(=O)CCC(=O)CCC(=O)O.
What is the InChIKey of 4,7-dioxoundecanoic acid?
The InChIKey is NUIDLEYBFLNNHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-2-3-4-9(12)5-6-10(13)7-8-11(14)15/h2-8H2,1H3,(H,14,15).
What are the key properties of 4,7-dioxoundecanoic acid?
4,7-dioxoundecanoic acid has a molecular weight of 214.26 g/mol, XLogP of 1.96, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dioxoundecanoic acid is sourced from PubChem (CID 165359282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).