About bis(butanedioic acid);decane
bis(butanedioic acid);decane (PubChem CID 159628544) has the molecular formula C18H34O8
and a molecular weight of 378.46 g/mol. Its IUPAC name is bis(butanedioic acid);decane.
Molecular Properties
| Compound Name | bis(butanedioic acid);decane |
| PubChem CID | 159628544 |
| Molecular Formula | C18H34O8 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | bis(butanedioic acid);decane |
| SMILES | CCCCCCCCCC.O=C(O)CCC(=O)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C10H22.2C4H6O4/c1-3-5-7-9-10-8-6-4-2;2*5-3(6)1-2-4(7)8/h3-10H2,1-2H3;2*1-2H2,(H,5,6)(H,7,8) |
| InChIKey | MOUWVEKVCVGQTL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(butanedioic acid);decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(butanedioic acid);decane?
The IUPAC name of bis(butanedioic acid);decane (CID 159628544) is bis(butanedioic acid);decane.
What is the SMILES notation for bis(butanedioic acid);decane?
The canonical SMILES for bis(butanedioic acid);decane is CCCCCCCCCC.O=C(O)CCC(=O)O.O=C(O)CCC(=O)O.
What is the InChIKey of bis(butanedioic acid);decane?
The InChIKey is MOUWVEKVCVGQTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22.2C4H6O4/c1-3-5-7-9-10-8-6-4-2;2*5-3(6)1-2-4(7)8/h3-10H2,1-2H3;2*1-2H2,(H,5,6)(H,7,8).
What are the key properties of bis(butanedioic acid);decane?
bis(butanedioic acid);decane has a molecular weight of 378.46 g/mol, XLogP of 4.02, 13 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(butanedioic acid);decane is sourced from PubChem (CID 159628544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).