About 2,10-diiodoundecan-6-one
2,10-diiodoundecan-6-one (PubChem CID 87448704) has the molecular formula C11H20I2O
and a molecular weight of 422.09 g/mol. Its IUPAC name is 2,10-diiodoundecan-6-one.
Molecular Properties
| Compound Name | 2,10-diiodoundecan-6-one |
| PubChem CID | 87448704 |
| Molecular Formula | C11H20I2O |
| Molecular Weight | 422.09 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | 2,10-diiodoundecan-6-one |
| SMILES | CC(I)CCCC(=O)CCCC(C)I |
| InChI | InChI=1S/C11H20I2O/c1-9(12)5-3-7-11(14)8-4-6-10(2)13/h9-10H,3-8H2,1-2H3 |
| InChIKey | OIAPMNBXFOREPD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.09 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,10-diiodoundecan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,10-diiodoundecan-6-one?
The IUPAC name of 2,10-diiodoundecan-6-one (CID 87448704) is 2,10-diiodoundecan-6-one.
What is the SMILES notation for 2,10-diiodoundecan-6-one?
The canonical SMILES for 2,10-diiodoundecan-6-one is CC(I)CCCC(=O)CCCC(C)I.
What is the InChIKey of 2,10-diiodoundecan-6-one?
The InChIKey is OIAPMNBXFOREPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20I2O/c1-9(12)5-3-7-11(14)8-4-6-10(2)13/h9-10H,3-8H2,1-2H3.
What are the key properties of 2,10-diiodoundecan-6-one?
2,10-diiodoundecan-6-one has a molecular weight of 422.09 g/mol, XLogP of 4.54, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,10-diiodoundecan-6-one is sourced from PubChem (CID 87448704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).