About (5S)-5-iodohexan-1-ol
(5S)-5-iodohexan-1-ol (PubChem CID 139766894) has the molecular formula C6H13IO
and a molecular weight of 228.07 g/mol. Its IUPAC name is (5S)-5-iodohexan-1-ol.
Molecular Properties
| Compound Name | (5S)-5-iodohexan-1-ol |
| PubChem CID | 139766894 |
| Molecular Formula | C6H13IO |
| Molecular Weight | 228.07 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | (5S)-5-iodohexan-1-ol |
| SMILES | C[C@H](I)CCCCO |
| InChI | InChI=1S/C6H13IO/c1-6(7)4-2-3-5-8/h6,8H,2-5H2,1H3/t6-/m0/s1 |
| InChIKey | QZZQNBKJOGXVDD-LURJTMIESA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.07 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-iodohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-iodohexan-1-ol?
The IUPAC name of (5S)-5-iodohexan-1-ol (CID 139766894) is (5S)-5-iodohexan-1-ol.
What is the SMILES notation for (5S)-5-iodohexan-1-ol?
The canonical SMILES for (5S)-5-iodohexan-1-ol is C[C@H](I)CCCCO.
What is the InChIKey of (5S)-5-iodohexan-1-ol?
The InChIKey is QZZQNBKJOGXVDD-LURJTMIESA-N. The full InChI is InChI=1S/C6H13IO/c1-6(7)4-2-3-5-8/h6,8H,2-5H2,1H3/t6-/m0/s1.
What are the key properties of (5S)-5-iodohexan-1-ol?
(5S)-5-iodohexan-1-ol has a molecular weight of 228.07 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-iodohexan-1-ol is sourced from PubChem (CID 139766894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).