About 16-methylheptadecan-1-ol;titanium
16-methylheptadecan-1-ol;titanium (PubChem CID 151630620) has the molecular formula C18H38OTi
and a molecular weight of 318.37 g/mol. Its IUPAC name is 16-methylheptadecan-1-ol;titanium.
Molecular Properties
| Compound Name | 16-methylheptadecan-1-ol;titanium |
| PubChem CID | 151630620 |
| Molecular Formula | C18H38OTi |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 16-methylheptadecan-1-ol;titanium |
| SMILES | CC(C)CCCCCCCCCCCCCCCO.[Ti] |
| InChI | InChI=1S/C18H38O.Ti/c1-18(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19;/h18-19H,3-17H2,1-2H3; |
| InChIKey | WXZHFAUEMSBVHO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 16-methylheptadecan-1-ol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 16-methylheptadecan-1-ol;titanium?
The IUPAC name of 16-methylheptadecan-1-ol;titanium (CID 151630620) is 16-methylheptadecan-1-ol;titanium.
What is the SMILES notation for 16-methylheptadecan-1-ol;titanium?
The canonical SMILES for 16-methylheptadecan-1-ol;titanium is CC(C)CCCCCCCCCCCCCCCO.[Ti].
What is the InChIKey of 16-methylheptadecan-1-ol;titanium?
The InChIKey is WXZHFAUEMSBVHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O.Ti/c1-18(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19;/h18-19H,3-17H2,1-2H3;.
What are the key properties of 16-methylheptadecan-1-ol;titanium?
16-methylheptadecan-1-ol;titanium has a molecular weight of 318.37 g/mol, XLogP of 6.09, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 16-methylheptadecan-1-ol;titanium is sourced from PubChem (CID 151630620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).