About trisodium;6-methylheptan-1-ol;phosphate
trisodium;6-methylheptan-1-ol;phosphate (PubChem CID 174850662) has the molecular formula C8H18Na3O5P
and a molecular weight of 294.17 g/mol. Its IUPAC name is trisodium;6-methylheptan-1-ol;phosphate.
Molecular Properties
| Compound Name | trisodium;6-methylheptan-1-ol;phosphate |
| PubChem CID | 174850662 |
| Molecular Formula | C8H18Na3O5P |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | trisodium;6-methylheptan-1-ol;phosphate |
| SMILES | CC(C)CCCCCO.O=P([O-])([O-])[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C8H18O.3Na.H3O4P/c1-8(2)6-4-3-5-7-9;;;;1-5(2,3)4/h8-9H,3-7H2,1-2H3;;;;(H3,1,2,3,4)/q;3*+1;/p-3 |
| InChIKey | XLFSNKGFBGDKEX-UHFFFAOYSA-K |
| XLogP | -9.62 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | -9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trisodium;6-methylheptan-1-ol;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;6-methylheptan-1-ol;phosphate?
The IUPAC name of trisodium;6-methylheptan-1-ol;phosphate (CID 174850662) is trisodium;6-methylheptan-1-ol;phosphate.
What is the SMILES notation for trisodium;6-methylheptan-1-ol;phosphate?
The canonical SMILES for trisodium;6-methylheptan-1-ol;phosphate is CC(C)CCCCCO.O=P([O-])([O-])[O-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;6-methylheptan-1-ol;phosphate?
The InChIKey is XLFSNKGFBGDKEX-UHFFFAOYSA-K. The full InChI is InChI=1S/C8H18O.3Na.H3O4P/c1-8(2)6-4-3-5-7-9;;;;1-5(2,3)4/h8-9H,3-7H2,1-2H3;;;;(H3,1,2,3,4)/q;3*+1;/p-3.
What are the key properties of trisodium;6-methylheptan-1-ol;phosphate?
trisodium;6-methylheptan-1-ol;phosphate has a molecular weight of 294.17 g/mol, XLogP of -9.62, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;6-methylheptan-1-ol;phosphate is sourced from PubChem (CID 174850662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).