About 6-methylheptan-1-ol;phosphoric acid;zirconium
6-methylheptan-1-ol;phosphoric acid;zirconium (PubChem CID 174855290) has the molecular formula C8H21O5PZr
and a molecular weight of 319.45 g/mol. Its IUPAC name is 6-methylheptan-1-ol;phosphoric acid;zirconium.
Molecular Properties
| Compound Name | 6-methylheptan-1-ol;phosphoric acid;zirconium |
| PubChem CID | 174855290 |
| Molecular Formula | C8H21O5PZr |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 6-methylheptan-1-ol;phosphoric acid;zirconium |
| SMILES | CC(C)CCCCCO.O=P(O)(O)O.[Zr] |
| InChI | InChI=1S/C8H18O.H3O4P.Zr/c1-8(2)6-4-3-5-7-9;1-5(2,3)4;/h8-9H,3-7H2,1-2H3;(H3,1,2,3,4); |
| InChIKey | KVHUNALEZSBKMC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-methylheptan-1-ol;phosphoric acid;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptan-1-ol;phosphoric acid;zirconium?
The IUPAC name of 6-methylheptan-1-ol;phosphoric acid;zirconium (CID 174855290) is 6-methylheptan-1-ol;phosphoric acid;zirconium.
What is the SMILES notation for 6-methylheptan-1-ol;phosphoric acid;zirconium?
The canonical SMILES for 6-methylheptan-1-ol;phosphoric acid;zirconium is CC(C)CCCCCO.O=P(O)(O)O.[Zr].
What is the InChIKey of 6-methylheptan-1-ol;phosphoric acid;zirconium?
The InChIKey is KVHUNALEZSBKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.H3O4P.Zr/c1-8(2)6-4-3-5-7-9;1-5(2,3)4;/h8-9H,3-7H2,1-2H3;(H3,1,2,3,4);.
What are the key properties of 6-methylheptan-1-ol;phosphoric acid;zirconium?
6-methylheptan-1-ol;phosphoric acid;zirconium has a molecular weight of 319.45 g/mol, XLogP of 1.26, 5 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptan-1-ol;phosphoric acid;zirconium is sourced from PubChem (CID 174855290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).