About sodium;hydride;8-methylnonan-1-ol
sodium;hydride;8-methylnonan-1-ol (PubChem CID 175362951) has the molecular formula C10H23NaO
and a molecular weight of 182.28 g/mol. Its IUPAC name is sodium;hydride;8-methylnonan-1-ol.
Molecular Properties
| Compound Name | sodium;hydride;8-methylnonan-1-ol |
| PubChem CID | 175362951 |
| Molecular Formula | C10H23NaO |
| Molecular Weight | 182.28 g/mol |
| Exact Mass | 182.16 |
| IUPAC Name | sodium;hydride;8-methylnonan-1-ol |
| SMILES | CC(C)CCCCCCCO.[H-].[Na+] |
| InChI | InChI=1S/C10H22O.Na.H/c1-10(2)8-6-4-3-5-7-9-11;;/h10-11H,3-9H2,1-2H3;;/q;+1;-1 |
| InChIKey | SCGGJTHUGJYAJN-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;8-methylnonan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;8-methylnonan-1-ol?
The IUPAC name of sodium;hydride;8-methylnonan-1-ol (CID 175362951) is sodium;hydride;8-methylnonan-1-ol.
What is the SMILES notation for sodium;hydride;8-methylnonan-1-ol?
The canonical SMILES for sodium;hydride;8-methylnonan-1-ol is CC(C)CCCCCCCO.[H-].[Na+].
What is the InChIKey of sodium;hydride;8-methylnonan-1-ol?
The InChIKey is SCGGJTHUGJYAJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O.Na.H/c1-10(2)8-6-4-3-5-7-9-11;;/h10-11H,3-9H2,1-2H3;;/q;+1;-1.
What are the key properties of sodium;hydride;8-methylnonan-1-ol?
sodium;hydride;8-methylnonan-1-ol has a molecular weight of 182.28 g/mol, XLogP of 0.09, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;8-methylnonan-1-ol is sourced from PubChem (CID 175362951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).