About alumane;6-methylheptan-1-ol
alumane;6-methylheptan-1-ol (PubChem CID 174615736) has the molecular formula C8H21AlO
and a molecular weight of 160.24 g/mol. Its IUPAC name is alumane;6-methylheptan-1-ol.
Molecular Properties
| Compound Name | alumane;6-methylheptan-1-ol |
| PubChem CID | 174615736 |
| Molecular Formula | C8H21AlO |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.14 |
| IUPAC Name | alumane;6-methylheptan-1-ol |
| SMILES | CC(C)CCCCCO.[AlH3] |
| InChI | InChI=1S/C8H18O.Al.3H/c1-8(2)6-4-3-5-7-9;;;;/h8-9H,3-7H2,1-2H3;;;; |
| InChIKey | YOVXGFNMRZGZRD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze alumane;6-methylheptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;6-methylheptan-1-ol?
The IUPAC name of alumane;6-methylheptan-1-ol (CID 174615736) is alumane;6-methylheptan-1-ol.
What is the SMILES notation for alumane;6-methylheptan-1-ol?
The canonical SMILES for alumane;6-methylheptan-1-ol is CC(C)CCCCCO.[AlH3].
What is the InChIKey of alumane;6-methylheptan-1-ol?
The InChIKey is YOVXGFNMRZGZRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.Al.3H/c1-8(2)6-4-3-5-7-9;;;;/h8-9H,3-7H2,1-2H3;;;;.
What are the key properties of alumane;6-methylheptan-1-ol?
alumane;6-methylheptan-1-ol has a molecular weight of 160.24 g/mol, XLogP of 1.01, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;6-methylheptan-1-ol is sourced from PubChem (CID 174615736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).