About 4-methylpentan-1-ol;titanium;dihydrate
4-methylpentan-1-ol;titanium;dihydrate (PubChem CID 175523375) has the molecular formula C6H18O3Ti
and a molecular weight of 186.07 g/mol. Its IUPAC name is 4-methylpentan-1-ol;titanium;dihydrate.
Molecular Properties
| Compound Name | 4-methylpentan-1-ol;titanium;dihydrate |
| PubChem CID | 175523375 |
| Molecular Formula | C6H18O3Ti |
| Molecular Weight | 186.07 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 4-methylpentan-1-ol;titanium;dihydrate |
| SMILES | CC(C)CCCO.O.O.[Ti] |
| InChI | InChI=1S/C6H14O.2H2O.Ti/c1-6(2)4-3-5-7;;;/h6-7H,3-5H2,1-2H3;2*1H2; |
| InChIKey | DVDDIEJJISRAKL-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 83.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.07 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylpentan-1-ol;titanium;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-1-ol;titanium;dihydrate?
The IUPAC name of 4-methylpentan-1-ol;titanium;dihydrate (CID 175523375) is 4-methylpentan-1-ol;titanium;dihydrate.
What is the SMILES notation for 4-methylpentan-1-ol;titanium;dihydrate?
The canonical SMILES for 4-methylpentan-1-ol;titanium;dihydrate is CC(C)CCCO.O.O.[Ti].
What is the InChIKey of 4-methylpentan-1-ol;titanium;dihydrate?
The InChIKey is DVDDIEJJISRAKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.2H2O.Ti/c1-6(2)4-3-5-7;;;/h6-7H,3-5H2,1-2H3;2*1H2;.
What are the key properties of 4-methylpentan-1-ol;titanium;dihydrate?
4-methylpentan-1-ol;titanium;dihydrate has a molecular weight of 186.07 g/mol, XLogP of -0.24, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-1-ol;titanium;dihydrate is sourced from PubChem (CID 175523375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).