C10H16O4 — CID 87255764
4,9-dioxodecanoic acid (PubChem CID 87255764) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 4,9-dioxodecanoic acid.
| Compound Name | 4,9-dioxodecanoic acid |
|---|---|
| PubChem CID | 87255764 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4,9-dioxodecanoic acid |
| SMILES | CC(=O)CCCCC(=O)CCC(=O)O |
| InChI | InChI=1S/C10H16O4/c1-8(11)4-2-3-5-9(12)6-7-10(13)14/h2-7H2,1H3,(H,13,14) |
| InChIKey | MNNBIBYGDDBGMT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|