C8H14O3 — CID 19604643
1-hydroxyoctane-2,7-dione (PubChem CID 19604643) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-hydroxyoctane-2,7-dione.
| Compound Name | 1-hydroxyoctane-2,7-dione |
|---|---|
| PubChem CID | 19604643 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 1-hydroxyoctane-2,7-dione |
| SMILES | CC(=O)CCCCC(=O)CO |
| InChI | InChI=1S/C8H14O3/c1-7(10)4-2-3-5-8(11)6-9/h9H,2-6H2,1H3 |
| InChIKey | UJBLOFNTRFPPHJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|