C20H35NO5 — CID 159429348
8,13-dioxo-13-(6-oxoheptylamino)tridecanoic acid (PubChem CID 159429348) has the molecular formula C20H35NO5 and a molecular weight of 369.50 g/mol. Its IUPAC name is 8,13-dioxo-13-(6-oxoheptylamino)tridecanoic acid.
| Compound Name | 8,13-dioxo-13-(6-oxoheptylamino)tridecanoic acid |
|---|---|
| PubChem CID | 159429348 |
| Molecular Formula | C20H35NO5 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 8,13-dioxo-13-(6-oxoheptylamino)tridecanoic acid |
| SMILES | CC(=O)CCCCCNC(=O)CCCCC(=O)CCCCCCC(=O)O |
| InChI | InChI=1S/C20H35NO5/c1-17(22)11-5-4-10-16-21-19(24)14-9-8-13-18(23)12-6-2-3-7-15-20(25)26/h2-16H2,1H3,(H,21,24)(H,25,26) |
| InChIKey | IFNOUGCMHBPENV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|