C40H72N2O11 — CID 157167737
8-[3-[2-[[3-(7-carboxyheptylamino)-3-oxopropoxy]methyl]-3-(3,12-dioxotridecoxy)-2-methylpropoxy]propanoylamino]octanoic acid (PubChem CID 157167737) has the molecular formula C40H72N2O11 and a molecular weight of 757.02 g/mol. Its IUPAC name is 8-[3-[2-[[3-(7-carboxyheptylamino)-3-oxopropoxy]methyl]-3-(3,12-dioxotridecoxy)-2-methylpropoxy]propanoylamino]octanoic acid.
| Compound Name | 8-[3-[2-[[3-(7-carboxyheptylamino)-3-oxopropoxy]methyl]-3-(3,12-dioxotridecoxy)-2-methylpropoxy]propanoylamino]octanoic acid |
|---|---|
| PubChem CID | 157167737 |
| Molecular Formula | C40H72N2O11 |
| Molecular Weight | 757.02 g/mol |
| Exact Mass | 756.51 |
| IUPAC Name | 8-[3-[2-[[3-(7-carboxyheptylamino)-3-oxopropoxy]methyl]-3-(3,12-dioxotridecoxy)-2-methylpropoxy]propanoylamino]octanoic acid |
| SMILES | CC(=O)CCCCCCCCC(=O)CCOCC(C)(COCCC(=O)NCCCCCCCC(=O)O)COCCC(=O)NCCCCCCCC(=O)O |
| InChI | InChI=1S/C40H72N2O11/c1-34(43)19-13-7-3-4-8-14-20-35(44)23-28-51-31-40(2,32-52-29-24-36(45)41-26-17-11-5-9-15-21-38(47)48)33-53-30-25-37(46)42-27-18-12-6-10-16-22-39(49)50/h3-33H2,1-2H3,(H,41,45)(H,42,46)(H,47,48)(H,49,50) |
| InChIKey | DSFXAIZQGRKXSF-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 194.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.02 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|