About 3-(2-hydroxyethyl)pentane-2,4-dione;iron
3-(2-hydroxyethyl)pentane-2,4-dione;iron (PubChem CID 174902322) has the molecular formula C7H12FeO3
and a molecular weight of 200.01 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)pentane-2,4-dione;iron.
Molecular Properties
| Compound Name | 3-(2-hydroxyethyl)pentane-2,4-dione;iron |
| PubChem CID | 174902322 |
| Molecular Formula | C7H12FeO3 |
| Molecular Weight | 200.01 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | 3-(2-hydroxyethyl)pentane-2,4-dione;iron |
| SMILES | CC(=O)C(CCO)C(C)=O.[Fe] |
| InChI | InChI=1S/C7H12O3.Fe/c1-5(9)7(3-4-8)6(2)10;/h7-8H,3-4H2,1-2H3; |
| InChIKey | GEMUEFWOCPIDBA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.01 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-hydroxyethyl)pentane-2,4-dione;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyethyl)pentane-2,4-dione;iron?
The IUPAC name of 3-(2-hydroxyethyl)pentane-2,4-dione;iron (CID 174902322) is 3-(2-hydroxyethyl)pentane-2,4-dione;iron.
What is the SMILES notation for 3-(2-hydroxyethyl)pentane-2,4-dione;iron?
The canonical SMILES for 3-(2-hydroxyethyl)pentane-2,4-dione;iron is CC(=O)C(CCO)C(C)=O.[Fe].
What is the InChIKey of 3-(2-hydroxyethyl)pentane-2,4-dione;iron?
The InChIKey is GEMUEFWOCPIDBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.Fe/c1-5(9)7(3-4-8)6(2)10;/h7-8H,3-4H2,1-2H3;.
What are the key properties of 3-(2-hydroxyethyl)pentane-2,4-dione;iron?
3-(2-hydroxyethyl)pentane-2,4-dione;iron has a molecular weight of 200.01 g/mol, XLogP of 0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyethyl)pentane-2,4-dione;iron is sourced from PubChem (CID 174902322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).