About 5-acetyl-6-oxoheptanal;zirconium
5-acetyl-6-oxoheptanal;zirconium (PubChem CID 87182173) has the molecular formula C9H14O3Zr
and a molecular weight of 261.43 g/mol. Its IUPAC name is 5-acetyl-6-oxoheptanal;zirconium.
Molecular Properties
| Compound Name | 5-acetyl-6-oxoheptanal;zirconium |
| PubChem CID | 87182173 |
| Molecular Formula | C9H14O3Zr |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 5-acetyl-6-oxoheptanal;zirconium |
| SMILES | CC(=O)C(CCCC=O)C(C)=O.[Zr] |
| InChI | InChI=1S/C9H14O3.Zr/c1-7(11)9(8(2)12)5-3-4-6-10;/h6,9H,3-5H2,1-2H3; |
| InChIKey | DIJJFQDJWOTGSN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-6-oxoheptanal;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-6-oxoheptanal;zirconium?
The IUPAC name of 5-acetyl-6-oxoheptanal;zirconium (CID 87182173) is 5-acetyl-6-oxoheptanal;zirconium.
What is the SMILES notation for 5-acetyl-6-oxoheptanal;zirconium?
The canonical SMILES for 5-acetyl-6-oxoheptanal;zirconium is CC(=O)C(CCCC=O)C(C)=O.[Zr].
What is the InChIKey of 5-acetyl-6-oxoheptanal;zirconium?
The InChIKey is DIJJFQDJWOTGSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3.Zr/c1-7(11)9(8(2)12)5-3-4-6-10;/h6,9H,3-5H2,1-2H3;.
What are the key properties of 5-acetyl-6-oxoheptanal;zirconium?
5-acetyl-6-oxoheptanal;zirconium has a molecular weight of 261.43 g/mol, XLogP of 1.15, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-6-oxoheptanal;zirconium is sourced from PubChem (CID 87182173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).