About dimethylphosphane;2-ethyl-3-oxobutanoic acid
dimethylphosphane;2-ethyl-3-oxobutanoic acid (PubChem CID 174298040) has the molecular formula C8H17O3P
and a molecular weight of 192.19 g/mol. Its IUPAC name is dimethylphosphane;2-ethyl-3-oxobutanoic acid.
Molecular Properties
| Compound Name | dimethylphosphane;2-ethyl-3-oxobutanoic acid |
| PubChem CID | 174298040 |
| Molecular Formula | C8H17O3P |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | dimethylphosphane;2-ethyl-3-oxobutanoic acid |
| SMILES | CCC(C(C)=O)C(=O)O.CPC |
| InChI | InChI=1S/C6H10O3.C2H7P/c1-3-5(4(2)7)6(8)9;1-3-2/h5H,3H2,1-2H3,(H,8,9);3H,1-2H3 |
| InChIKey | UXIYMXJVOHJFAQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethylphosphane;2-ethyl-3-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylphosphane;2-ethyl-3-oxobutanoic acid?
The IUPAC name of dimethylphosphane;2-ethyl-3-oxobutanoic acid (CID 174298040) is dimethylphosphane;2-ethyl-3-oxobutanoic acid.
What is the SMILES notation for dimethylphosphane;2-ethyl-3-oxobutanoic acid?
The canonical SMILES for dimethylphosphane;2-ethyl-3-oxobutanoic acid is CCC(C(C)=O)C(=O)O.CPC.
What is the InChIKey of dimethylphosphane;2-ethyl-3-oxobutanoic acid?
The InChIKey is UXIYMXJVOHJFAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C2H7P/c1-3-5(4(2)7)6(8)9;1-3-2/h5H,3H2,1-2H3,(H,8,9);3H,1-2H3.
What are the key properties of dimethylphosphane;2-ethyl-3-oxobutanoic acid?
dimethylphosphane;2-ethyl-3-oxobutanoic acid has a molecular weight of 192.19 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylphosphane;2-ethyl-3-oxobutanoic acid is sourced from PubChem (CID 174298040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).