dimethylphosphane;2-ethyl-3-oxobutanoic acid

C8H17O3P — CID 174298040

IUPACdimethylphosphane;2-ethyl-3-oxobutanoic acid
SMILESCCC(C(C)=O)C(=O)O.CPC
InChIInChI=1S/C6H10O3.C2H7P/c1-3-5(4(2)7)6(8)9;1-3-2/h5H,3H2,1-2H3,(H,8,9);3H,1-2H3
InChIKeyUXIYMXJVOHJFAQ-UHFFFAOYSA-N
MW192.19 g/mol
LogP1.61
Rot. Bonds3

About dimethylphosphane;2-ethyl-3-oxobutanoic acid

dimethylphosphane;2-ethyl-3-oxobutanoic acid (PubChem CID 174298040) has the molecular formula C8H17O3P and a molecular weight of 192.19 g/mol. Its IUPAC name is dimethylphosphane;2-ethyl-3-oxobutanoic acid.

Molecular Properties

Compound Namedimethylphosphane;2-ethyl-3-oxobutanoic acid
PubChem CID174298040
Molecular FormulaC8H17O3P
Molecular Weight192.19 g/mol
Exact Mass192.09
IUPAC Namedimethylphosphane;2-ethyl-3-oxobutanoic acid
SMILESCCC(C(C)=O)C(=O)O.CPC
InChIInChI=1S/C6H10O3.C2H7P/c1-3-5(4(2)7)6(8)9;1-3-2/h5H,3H2,1-2H3,(H,8,9);3H,1-2H3
InChIKeyUXIYMXJVOHJFAQ-UHFFFAOYSA-N
XLogP1.61
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.19
LogP ≤ 51.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze dimethylphosphane;2-ethyl-3-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dimethylphosphane;2-ethyl-3-oxobutanoic acid?
The IUPAC name of dimethylphosphane;2-ethyl-3-oxobutanoic acid (CID 174298040) is dimethylphosphane;2-ethyl-3-oxobutanoic acid.
What is the SMILES notation for dimethylphosphane;2-ethyl-3-oxobutanoic acid?
The canonical SMILES for dimethylphosphane;2-ethyl-3-oxobutanoic acid is CCC(C(C)=O)C(=O)O.CPC.
What is the InChIKey of dimethylphosphane;2-ethyl-3-oxobutanoic acid?
The InChIKey is UXIYMXJVOHJFAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C2H7P/c1-3-5(4(2)7)6(8)9;1-3-2/h5H,3H2,1-2H3,(H,8,9);3H,1-2H3.
What are the key properties of dimethylphosphane;2-ethyl-3-oxobutanoic acid?
dimethylphosphane;2-ethyl-3-oxobutanoic acid has a molecular weight of 192.19 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylphosphane;2-ethyl-3-oxobutanoic acid is sourced from PubChem (CID 174298040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).