C16H29AlO7 — CID 87196528
CID 87196528 (PubChem CID 87196528) has the molecular formula C16H29AlO7 and a molecular weight of 360.38 g/mol.
| Compound Name | CID 87196528 |
|---|---|
| PubChem CID | 87196528 |
| Molecular Formula | C16H29AlO7 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | — |
| SMILES | CC(C)CO[Al].CCC(C(C)=O)C(=O)O.CCC(C(C)=O)C(=O)O |
| InChI | InChI=1S/2C6H10O3.C4H9O.Al/c2*1-3-5(4(2)7)6(8)9;1-4(2)3-5;/h2*5H,3H2,1-2H3,(H,8,9);4H,3H2,1-2H3;/q;;-1;+1 |
| InChIKey | FRGJVILWZMTFKR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|