About acetic acid;2-methylbutane
acetic acid;2-methylbutane (PubChem CID 172862544) has the molecular formula C7H16O2
and a molecular weight of 132.20 g/mol. Its IUPAC name is acetic acid;2-methylbutane.
Molecular Properties
| Compound Name | acetic acid;2-methylbutane |
| PubChem CID | 172862544 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | acetic acid;2-methylbutane |
| SMILES | CC(=O)O.CCC(C)C |
| InChI | InChI=1S/C5H12.C2H4O2/c1-4-5(2)3;1-2(3)4/h5H,4H2,1-3H3;1H3,(H,3,4) |
| InChIKey | ZNYHOLYIMVKBMZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-methylbutane?
The IUPAC name of acetic acid;2-methylbutane (CID 172862544) is acetic acid;2-methylbutane.
What is the SMILES notation for acetic acid;2-methylbutane?
The canonical SMILES for acetic acid;2-methylbutane is CC(=O)O.CCC(C)C.
What is the InChIKey of acetic acid;2-methylbutane?
The InChIKey is ZNYHOLYIMVKBMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.C2H4O2/c1-4-5(2)3;1-2(3)4/h5H,4H2,1-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-methylbutane?
acetic acid;2-methylbutane has a molecular weight of 132.20 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-methylbutane is sourced from PubChem (CID 172862544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).