About hydroxylamine;2-methylbutane
hydroxylamine;2-methylbutane (PubChem CID 175063986) has the molecular formula C5H15NO
and a molecular weight of 105.18 g/mol. Its IUPAC name is hydroxylamine;2-methylbutane.
Molecular Properties
| Compound Name | hydroxylamine;2-methylbutane |
| PubChem CID | 175063986 |
| Molecular Formula | C5H15NO |
| Molecular Weight | 105.18 g/mol |
| Exact Mass | 105.12 |
| IUPAC Name | hydroxylamine;2-methylbutane |
| SMILES | CCC(C)C.NO |
| InChI | InChI=1S/C5H12.H3NO/c1-4-5(2)3;1-2/h5H,4H2,1-3H3;2H,1H2 |
| InChIKey | AIQVCEUEBVUVGJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxylamine;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxylamine;2-methylbutane?
The IUPAC name of hydroxylamine;2-methylbutane (CID 175063986) is hydroxylamine;2-methylbutane.
What is the SMILES notation for hydroxylamine;2-methylbutane?
The canonical SMILES for hydroxylamine;2-methylbutane is CCC(C)C.NO.
What is the InChIKey of hydroxylamine;2-methylbutane?
The InChIKey is AIQVCEUEBVUVGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.H3NO/c1-4-5(2)3;1-2/h5H,4H2,1-3H3;2H,1H2.
What are the key properties of hydroxylamine;2-methylbutane?
hydroxylamine;2-methylbutane has a molecular weight of 105.18 g/mol, XLogP of 1.39, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxylamine;2-methylbutane is sourced from PubChem (CID 175063986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).