About CID 169430456
CID 169430456 (PubChem CID 169430456) has the molecular formula C8H21BN
and a molecular weight of 142.07 g/mol.
Molecular Properties
| Compound Name | CID 169430456 |
| PubChem CID | 169430456 |
| Molecular Formula | C8H21BN |
| Molecular Weight | 142.07 g/mol |
| Exact Mass | 142.18 |
| IUPAC Name | — |
| SMILES | CC(C)N.CCC(C)C.[B] |
| InChI | InChI=1S/C5H12.C3H9N.B/c1-4-5(2)3;1-3(2)4;/h5H,4H2,1-3H3;3H,4H2,1-2H3; |
| InChIKey | NFELWXDEBISUAZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.07 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169430456 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169430456?
The IUPAC name of CID 169430456 (CID 169430456) is not available.
What is the SMILES notation for CID 169430456?
The canonical SMILES for CID 169430456 is CC(C)N.CCC(C)C.[B].
What is the InChIKey of CID 169430456?
The InChIKey is NFELWXDEBISUAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.C3H9N.B/c1-4-5(2)3;1-3(2)4;/h5H,4H2,1-3H3;3H,4H2,1-2H3;.
What are the key properties of CID 169430456?
CID 169430456 has a molecular weight of 142.07 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169430456 is sourced from PubChem (CID 169430456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).