About iodosilver;2-methylbutane
iodosilver;2-methylbutane (PubChem CID 174297027) has the molecular formula C5H12AgI
and a molecular weight of 306.92 g/mol. Its IUPAC name is iodosilver;2-methylbutane.
Molecular Properties
| Compound Name | iodosilver;2-methylbutane |
| PubChem CID | 174297027 |
| Molecular Formula | C5H12AgI |
| Molecular Weight | 306.92 g/mol |
| Exact Mass | 305.90 |
| IUPAC Name | iodosilver;2-methylbutane |
| SMILES | CCC(C)C.[Ag]I |
| InChI | InChI=1S/C5H12.Ag.HI/c1-4-5(2)3;;/h5H,4H2,1-3H3;;1H/q;+1;/p-1 |
| InChIKey | XFADMIXJVRIVPW-UHFFFAOYSA-M |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.92 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodosilver;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodosilver;2-methylbutane?
The IUPAC name of iodosilver;2-methylbutane (CID 174297027) is iodosilver;2-methylbutane.
What is the SMILES notation for iodosilver;2-methylbutane?
The canonical SMILES for iodosilver;2-methylbutane is CCC(C)C.[Ag]I.
What is the InChIKey of iodosilver;2-methylbutane?
The InChIKey is XFADMIXJVRIVPW-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H12.Ag.HI/c1-4-5(2)3;;/h5H,4H2,1-3H3;;1H/q;+1;/p-1.
What are the key properties of iodosilver;2-methylbutane?
iodosilver;2-methylbutane has a molecular weight of 306.92 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for iodosilver;2-methylbutane is sourced from PubChem (CID 174297027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).