About bis(but-2-yne);ethane;2-methylbutane
bis(but-2-yne);ethane;2-methylbutane (PubChem CID 144516003) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is bis(but-2-yne);ethane;2-methylbutane.
Molecular Properties
| Compound Name | bis(but-2-yne);ethane;2-methylbutane |
| PubChem CID | 144516003 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | bis(but-2-yne);ethane;2-methylbutane |
| SMILES | CC.CC#CC.CC#CC.CCC(C)C |
| InChI | InChI=1S/C5H12.2C4H6.C2H6/c1-4-5(2)3;2*1-3-4-2;1-2/h5H,4H2,1-3H3;2*1-2H3;1-2H3 |
| InChIKey | FDWRQVXDXMKKJB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(but-2-yne);ethane;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(but-2-yne);ethane;2-methylbutane?
The IUPAC name of bis(but-2-yne);ethane;2-methylbutane (CID 144516003) is bis(but-2-yne);ethane;2-methylbutane.
What is the SMILES notation for bis(but-2-yne);ethane;2-methylbutane?
The canonical SMILES for bis(but-2-yne);ethane;2-methylbutane is CC.CC#CC.CC#CC.CCC(C)C.
What is the InChIKey of bis(but-2-yne);ethane;2-methylbutane?
The InChIKey is FDWRQVXDXMKKJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.2C4H6.C2H6/c1-4-5(2)3;2*1-3-4-2;1-2/h5H,4H2,1-3H3;2*1-2H3;1-2H3.
What are the key properties of bis(but-2-yne);ethane;2-methylbutane?
bis(but-2-yne);ethane;2-methylbutane has a molecular weight of 210.40 g/mol, XLogP of 5.14, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(but-2-yne);ethane;2-methylbutane is sourced from PubChem (CID 144516003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).