C28H16 — CID 159623908
2-methylbutane;tricosa-1,3,5,7,9,11,13,15,17,19,21-undecayne (PubChem CID 159623908) has the molecular formula C28H16 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-methylbutane;tricosa-1,3,5,7,9,11,13,15,17,19,21-undecayne.
| Compound Name | 2-methylbutane;tricosa-1,3,5,7,9,11,13,15,17,19,21-undecayne |
|---|---|
| PubChem CID | 159623908 |
| Molecular Formula | C28H16 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-methylbutane;tricosa-1,3,5,7,9,11,13,15,17,19,21-undecayne |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC.CCC(C)C |
| InChI | InChI=1S/C23H4.C5H12/c1-3-5-7-9-11-13-15-17-19-21-23-22-20-18-16-14-12-10-8-6-4-2;1-4-5(2)3/h1H,2H3;5H,4H2,1-3H3 |
| InChIKey | MOFXKXGDRJIRKD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|