C37H46 — CID 159743950
heptadeca-1,3,5,7,9,11,13,15-octayne;2-methylnonadecane (PubChem CID 159743950) has the molecular formula C37H46 and a molecular weight of 490.78 g/mol. Its IUPAC name is heptadeca-1,3,5,7,9,11,13,15-octayne;2-methylnonadecane.
| Compound Name | heptadeca-1,3,5,7,9,11,13,15-octayne;2-methylnonadecane |
|---|---|
| PubChem CID | 159743950 |
| Molecular Formula | C37H46 |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 490.36 |
| IUPAC Name | heptadeca-1,3,5,7,9,11,13,15-octayne;2-methylnonadecane |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC.CCCCCCCCCCCCCCCCCC(C)C |
| InChI | InChI=1S/C20H42.C17H4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)3;1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2/h20H,4-19H2,1-3H3;1H,2H3 |
| InChIKey | NCUSENNPGPUICG-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|